About formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one
formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one (PubChem CID 90719006) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one.
Molecular Properties
| Compound Name | formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one |
| PubChem CID | 90719006 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one |
| SMILES | C=O.Cc1occ(O)c(=O)c1C |
| InChI | InChI=1S/C7H8O3.CH2O/c1-4-5(2)10-3-6(8)7(4)9;1-2/h3,8H,1-2H3;1H2 |
| InChIKey | AMSMCHBCMPXQAA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one?
The IUPAC name of formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one (CID 90719006) is formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one.
What is the SMILES notation for formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one?
The canonical SMILES for formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one is C=O.Cc1occ(O)c(=O)c1C.
What is the InChIKey of formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one?
The InChIKey is AMSMCHBCMPXQAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3.CH2O/c1-4-5(2)10-3-6(8)7(4)9;1-2/h3,8H,1-2H3;1H2.
What are the key properties of formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one?
formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one has a molecular weight of 170.16 g/mol, XLogP of 0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;5-hydroxy-2,3-dimethylpyran-4-one is sourced from PubChem (CID 90719006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).