C27H17F7N4O6 — CID 90719110
[1-[2-(methoxycarbonylamino)-3H-benzimidazol-5-yl]-3-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]isoindol-1-yl] 2,2,2-trifluoroacetate (PubChem CID 90719110) has the molecular formula C27H17F7N4O6 and a molecular weight of 626.44 g/mol. Its IUPAC name is [1-[2-(methoxycarbonylamino)-3H-benzimidazol-5-yl]-3-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]isoindol-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[2-(methoxycarbonylamino)-3H-benzimidazol-5-yl]-3-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]isoindol-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90719110 |
| Molecular Formula | C27H17F7N4O6 |
| Molecular Weight | 626.44 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | [1-[2-(methoxycarbonylamino)-3H-benzimidazol-5-yl]-3-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]isoindol-1-yl] 2,2,2-trifluoroacetate |
| SMILES | COC(=O)Nc1nc2ccc(C3(OC(=O)C(F)(F)F)c4ccccc4C(=O)N3c3cccc(OC(F)(F)C(F)F)c3)cc2[nH]1 |
| InChI | InChI=1S/C27H17F7N4O6/c1-42-24(41)37-23-35-18-10-9-13(11-19(18)36-23)25(44-22(40)26(30,31)32)17-8-3-2-7-16(17)20(39)38(25)14-5-4-6-15(12-14)43-27(33,34)21(28)29/h2-12,21H,1H3,(H2,35,36,37,41) |
| InChIKey | LTRALDHQWVNJRO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|