About 2-(1H-inden-2-yl)-1,3,4-oxadiazole
2-(1H-inden-2-yl)-1,3,4-oxadiazole (PubChem CID 90719234) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-(1H-inden-2-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(1H-inden-2-yl)-1,3,4-oxadiazole |
| PubChem CID | 90719234 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-(1H-inden-2-yl)-1,3,4-oxadiazole |
| SMILES | C1=C(c2nnco2)Cc2ccccc21 |
| InChI | InChI=1S/C11H8N2O/c1-2-4-9-6-10(5-8(9)3-1)11-13-12-7-14-11/h1-5,7H,6H2 |
| InChIKey | GSVZEUBXIJMKKP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-inden-2-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-inden-2-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-(1H-inden-2-yl)-1,3,4-oxadiazole (CID 90719234) is 2-(1H-inden-2-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-(1H-inden-2-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-(1H-inden-2-yl)-1,3,4-oxadiazole is C1=C(c2nnco2)Cc2ccccc21.
What is the InChIKey of 2-(1H-inden-2-yl)-1,3,4-oxadiazole?
The InChIKey is GSVZEUBXIJMKKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c1-2-4-9-6-10(5-8(9)3-1)11-13-12-7-14-11/h1-5,7H,6H2.
What are the key properties of 2-(1H-inden-2-yl)-1,3,4-oxadiazole?
2-(1H-inden-2-yl)-1,3,4-oxadiazole has a molecular weight of 184.20 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-inden-2-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 90719234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).