C13H7F13N4 — CID 90719298
1-[[1-methyl-4-(trifluoromethyl)pyrazol-3-yl]methyl]-3,5-bis(1,1,2,2,2-pentafluoroethyl)pyrazole (PubChem CID 90719298) has the molecular formula C13H7F13N4 and a molecular weight of 466.20 g/mol. Its IUPAC name is 1-[[1-methyl-4-(trifluoromethyl)pyrazol-3-yl]methyl]-3,5-bis(1,1,2,2,2-pentafluoroethyl)pyrazole.
| Compound Name | 1-[[1-methyl-4-(trifluoromethyl)pyrazol-3-yl]methyl]-3,5-bis(1,1,2,2,2-pentafluoroethyl)pyrazole |
|---|---|
| PubChem CID | 90719298 |
| Molecular Formula | C13H7F13N4 |
| Molecular Weight | 466.20 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 1-[[1-methyl-4-(trifluoromethyl)pyrazol-3-yl]methyl]-3,5-bis(1,1,2,2,2-pentafluoroethyl)pyrazole |
| SMILES | Cn1cc(C(F)(F)F)c(Cn2nc(C(F)(F)C(F)(F)F)cc2C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C13H7F13N4/c1-29-3-5(11(18,19)20)6(27-29)4-30-8(10(16,17)13(24,25)26)2-7(28-30)9(14,15)12(21,22)23/h2-3H,4H2,1H3 |
| InChIKey | ZDAQYUKRQIYYDG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.20 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|