About CID 90719731
CID 90719731 (PubChem CID 90719731) has the molecular formula C17H29BO3S2
and a molecular weight of 356.36 g/mol.
Molecular Properties
| Compound Name | CID 90719731 |
| PubChem CID | 90719731 |
| Molecular Formula | C17H29BO3S2 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | — |
| SMILES | [B]CCC1CCCC(S(=O)(=O)C(CC)S(=O)C2=CCCCC2)C1 |
| InChI | InChI=1S/C17H29BO3S2/c1-2-17(22(19)15-8-4-3-5-9-15)23(20,21)16-10-6-7-14(13-16)11-12-18/h8,14,16-17H,2-7,9-13H2,1H3 |
| InChIKey | XVSWHXQKTLFGNX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90719731 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90719731?
The IUPAC name of CID 90719731 (CID 90719731) is not available.
What is the SMILES notation for CID 90719731?
The canonical SMILES for CID 90719731 is [B]CCC1CCCC(S(=O)(=O)C(CC)S(=O)C2=CCCCC2)C1.
What is the InChIKey of CID 90719731?
The InChIKey is XVSWHXQKTLFGNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29BO3S2/c1-2-17(22(19)15-8-4-3-5-9-15)23(20,21)16-10-6-7-14(13-16)11-12-18/h8,14,16-17H,2-7,9-13H2,1H3.
What are the key properties of CID 90719731?
CID 90719731 has a molecular weight of 356.36 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90719731 is sourced from PubChem (CID 90719731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).