C22H24ClFN2O — CID 90719863
7-chloro-2-[(4-fluorophenyl)methyl]-5-[(1-methylpiperidin-4-yl)methyl]isoindol-1-ol (PubChem CID 90719863) has the molecular formula C22H24ClFN2O and a molecular weight of 386.90 g/mol. Its IUPAC name is 7-chloro-2-[(4-fluorophenyl)methyl]-5-[(1-methylpiperidin-4-yl)methyl]isoindol-1-ol.
| Compound Name | 7-chloro-2-[(4-fluorophenyl)methyl]-5-[(1-methylpiperidin-4-yl)methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90719863 |
| Molecular Formula | C22H24ClFN2O |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 7-chloro-2-[(4-fluorophenyl)methyl]-5-[(1-methylpiperidin-4-yl)methyl]isoindol-1-ol |
| SMILES | CN1CCC(Cc2cc(Cl)c3c(O)n(Cc4ccc(F)cc4)cc3c2)CC1 |
| InChI | InChI=1S/C22H24ClFN2O/c1-25-8-6-15(7-9-25)10-17-11-18-14-26(22(27)21(18)20(23)12-17)13-16-2-4-19(24)5-3-16/h2-5,11-12,14-15,27H,6-10,13H2,1H3 |
| InChIKey | HSUUCUSQMWMPCM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |