C49H38N4O2 — CID 90720041
2-[3,5-di(carbazol-9-yl)phenyl]-5-[3-(6-ethenylnona-3,5,7-trienoxy)phenyl]-1,3,4-oxadiazole (PubChem CID 90720041) has the molecular formula C49H38N4O2 and a molecular weight of 714.87 g/mol. Its IUPAC name is 2-[3,5-di(carbazol-9-yl)phenyl]-5-[3-(6-ethenylnona-3,5,7-trienoxy)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[3,5-di(carbazol-9-yl)phenyl]-5-[3-(6-ethenylnona-3,5,7-trienoxy)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90720041 |
| Molecular Formula | C49H38N4O2 |
| Molecular Weight | 714.87 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | 2-[3,5-di(carbazol-9-yl)phenyl]-5-[3-(6-ethenylnona-3,5,7-trienoxy)phenyl]-1,3,4-oxadiazole |
| SMILES | C=CC(C=CC)=CC=CCCOc1cccc(-c2nnc(-c3cc(-n4c5ccccc5c5ccccc54)cc(-n4c5ccccc5c5ccccc54)c3)o2)c1 |
| InChI | InChI=1S/C49H38N4O2/c1-3-17-34(4-2)18-6-5-15-29-54-39-20-16-19-35(32-39)48-50-51-49(55-48)36-30-37(52-44-25-11-7-21-40(44)41-22-8-12-26-45(41)52)33-38(31-36)53-46-27-13-9-23-42(46)43-24-10-14-28-47(43)53/h3-14,16-28,30-33H,2,15,29H2,1H3 |
| InChIKey | GQRGXYWPQHTRBA-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 58.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.87 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|