C29H31F3N2O6 — CID 90720454
18-(dimethoxymethyl)-4-(dimethylamino)-8-ethenyl-11,16-dimethyl-19-(trifluoromethyl)-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,15(20),16,18-pentaene-10,12,14-trione (PubChem CID 90720454) has the molecular formula C29H31F3N2O6 and a molecular weight of 560.57 g/mol. Its IUPAC name is 18-(dimethoxymethyl)-4-(dimethylamino)-8-ethenyl-11,16-dimethyl-19-(trifluoromethyl)-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,15(20),16,18-pentaene-10,12,14-trione.
| Compound Name | 18-(dimethoxymethyl)-4-(dimethylamino)-8-ethenyl-11,16-dimethyl-19-(trifluoromethyl)-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,15(20),16,18-pentaene-10,12,14-trione |
|---|---|
| PubChem CID | 90720454 |
| Molecular Formula | C29H31F3N2O6 |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 18-(dimethoxymethyl)-4-(dimethylamino)-8-ethenyl-11,16-dimethyl-19-(trifluoromethyl)-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,15(20),16,18-pentaene-10,12,14-trione |
| SMILES | C=Cc1noc2c1C(=O)C1(C)C(=O)C3C(=O)c4c(C)cc(C(OC)OC)c(C(F)(F)F)c4CC3CC1C2N(C)C |
| InChI | InChI=1S/C29H31F3N2O6/c1-8-17-20-24(40-33-17)22(34(4)5)16-11-13-10-14-18(23(35)19(13)25(36)28(16,3)26(20)37)12(2)9-15(27(38-6)39-7)21(14)29(30,31)32/h8-9,13,16,19,22,27H,1,10-11H2,2-7H3 |
| InChIKey | QOEHCAUVDQBDRR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|