C40H37N3O8 — CID 90721283
(2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoate (PubChem CID 90721283) has the molecular formula C40H37N3O8 and a molecular weight of 687.75 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 90721283 |
| Molecular Formula | C40H37N3O8 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.26 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoate |
| SMILES | NCCCC[C@@H](C(=O)On1c(O)ccc1O)N(C(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H37N3O8/c41-22-10-9-19-35(38(46)51-43-36(44)20-21-37(43)45)42(39(47)49-23-33-29-15-5-1-11-25(29)26-12-2-6-16-30(26)33)40(48)50-24-34-31-17-7-3-13-27(31)28-14-4-8-18-32(28)34/h1-8,11-18,20-21,33-35,44-45H,9-10,19,22-24,41H2/t35-/m0/s1 |
| InChIKey | WNNLCXLIIBURKE-DHUJRADRSA-N |
| XLogP | 6.55 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|