C18H32N2 — CID 90721381
N-[2-(2,6-dimethylcyclohexen-1-yl)iminoethyl]-2,6-dimethylcyclohexan-1-amine (PubChem CID 90721381) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is N-[2-(2,6-dimethylcyclohexen-1-yl)iminoethyl]-2,6-dimethylcyclohexan-1-amine.
| Compound Name | N-[2-(2,6-dimethylcyclohexen-1-yl)iminoethyl]-2,6-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 90721381 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | N-[2-(2,6-dimethylcyclohexen-1-yl)iminoethyl]-2,6-dimethylcyclohexan-1-amine |
| SMILES | CC1=C(/N=C/CNC2C(C)CCCC2C)C(C)CCC1 |
| InChI | InChI=1S/C18H32N2/c1-13-7-5-8-14(2)17(13)19-11-12-20-18-15(3)9-6-10-16(18)4/h11,13,15-16,18,20H,5-10,12H2,1-4H3/b19-11+ |
| InChIKey | KLPAXUMZJUQWOT-YBFXNURJSA-N |
| XLogP | 4.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|