About 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate
10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate (PubChem CID 90721415) has the molecular formula C22H34O4
and a molecular weight of 362.51 g/mol. Its IUPAC name is 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate.
Molecular Properties
| Compound Name | 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate |
| PubChem CID | 90721415 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate |
| SMILES | C=CC(C#CC#CCCC(CCCCCCC)OC(C)(C)O)OC(C)=O |
| InChI | InChI=1S/C22H34O4/c1-6-8-9-10-14-17-21(26-22(4,5)24)18-15-12-11-13-16-20(7-2)25-19(3)23/h7,20-21,24H,2,6,8-10,14-15,17-18H2,1,3-5H3 |
| InChIKey | ANLBEGDVYHPTDV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate?
The IUPAC name of 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate (CID 90721415) is 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate.
What is the SMILES notation for 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate?
The canonical SMILES for 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate is C=CC(C#CC#CCCC(CCCCCCC)OC(C)(C)O)OC(C)=O.
What is the InChIKey of 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate?
The InChIKey is ANLBEGDVYHPTDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O4/c1-6-8-9-10-14-17-21(26-22(4,5)24)18-15-12-11-13-16-20(7-2)25-19(3)23/h7,20-21,24H,2,6,8-10,14-15,17-18H2,1,3-5H3.
What are the key properties of 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate?
10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate has a molecular weight of 362.51 g/mol, XLogP of 4.37, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl acetate is sourced from PubChem (CID 90721415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).