C19H18FNO6 — CID 90721936
1-(2,3-dihydroxypropyl)-4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]pyrrolidine-2,3-dione (PubChem CID 90721936) has the molecular formula C19H18FNO6 and a molecular weight of 375.35 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]pyrrolidine-2,3-dione.
| Compound Name | 1-(2,3-dihydroxypropyl)-4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 90721936 |
| Molecular Formula | C19H18FNO6 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CC(O)CO)CC1C(=O)c1ccc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C19H18FNO6/c20-12-3-1-11(2-4-12)7-14-5-6-16(27-14)17(24)15-9-21(8-13(23)10-22)19(26)18(15)25/h1-6,13,15,22-23H,7-10H2 |
| InChIKey | BXPSCHOLVNPUBG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|