C21H14F3N — CID 90722010
3-[2-methyl-4-[2-(trifluoromethyl)phenyl]phenyl]benzonitrile (PubChem CID 90722010) has the molecular formula C21H14F3N and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-[2-methyl-4-[2-(trifluoromethyl)phenyl]phenyl]benzonitrile.
| Compound Name | 3-[2-methyl-4-[2-(trifluoromethyl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 90722010 |
| Molecular Formula | C21H14F3N |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-[2-methyl-4-[2-(trifluoromethyl)phenyl]phenyl]benzonitrile |
| SMILES | Cc1cc(-c2ccccc2C(F)(F)F)ccc1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C21H14F3N/c1-14-11-17(19-7-2-3-8-20(19)21(22,23)24)9-10-18(14)16-6-4-5-15(12-16)13-25/h2-12H,1H3 |
| InChIKey | HOCRMGUABRJVOD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |