C39H40F10O6 — CID 90722043
2,2,3,3,3-pentafluoropropyl 2-[(6-butan-2-ylnaphthalen-2-yl)methoxy]acetate;2,2,3,3,3-pentafluoropropyl 2-(6-butan-2-ylnaphthalen-2-yl)oxyacetate (PubChem CID 90722043) has the molecular formula C39H40F10O6 and a molecular weight of 794.72 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 2-[(6-butan-2-ylnaphthalen-2-yl)methoxy]acetate;2,2,3,3,3-pentafluoropropyl 2-(6-butan-2-ylnaphthalen-2-yl)oxyacetate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 2-[(6-butan-2-ylnaphthalen-2-yl)methoxy]acetate;2,2,3,3,3-pentafluoropropyl 2-(6-butan-2-ylnaphthalen-2-yl)oxyacetate |
|---|---|
| PubChem CID | 90722043 |
| Molecular Formula | C39H40F10O6 |
| Molecular Weight | 794.72 g/mol |
| Exact Mass | 794.27 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-[(6-butan-2-ylnaphthalen-2-yl)methoxy]acetate;2,2,3,3,3-pentafluoropropyl 2-(6-butan-2-ylnaphthalen-2-yl)oxyacetate |
| SMILES | CCC(C)c1ccc2cc(COCC(=O)OCC(F)(F)C(F)(F)F)ccc2c1.CCC(C)c1ccc2cc(OCC(=O)OCC(F)(F)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C20H21F5O3.C19H19F5O3/c1-3-13(2)15-6-7-16-8-14(4-5-17(16)9-15)10-27-11-18(26)28-12-19(21,22)20(23,24)25;1-3-12(2)13-4-5-15-9-16(7-6-14(15)8-13)26-10-17(25)27-11-18(20,21)19(22,23)24/h4-9,13H,3,10-12H2,1-2H3;4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | LFDUJYPTZNZVAL-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.72 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|