About 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine
5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine (PubChem CID 90722764) has the molecular formula C19H24N6
and a molecular weight of 336.44 g/mol. Its IUPAC name is 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine.
Molecular Properties
| Compound Name | 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine |
| PubChem CID | 90722764 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine |
| SMILES | C[C@@H](c1ccccc1)n1cnc2ncc(CN3CCN(C)CC3)nc21 |
| InChI | InChI=1S/C19H24N6/c1-15(16-6-4-3-5-7-16)25-14-21-18-19(25)22-17(12-20-18)13-24-10-8-23(2)9-11-24/h3-7,12,14-15H,8-11,13H2,1-2H3/t15-/m0/s1 |
| InChIKey | AOOBKIYNHPNTFX-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine?
The IUPAC name of 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine (CID 90722764) is 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine.
What is the SMILES notation for 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine?
The canonical SMILES for 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine is C[C@@H](c1ccccc1)n1cnc2ncc(CN3CCN(C)CC3)nc21.
What is the InChIKey of 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine?
The InChIKey is AOOBKIYNHPNTFX-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H24N6/c1-15(16-6-4-3-5-7-16)25-14-21-18-19(25)22-17(12-20-18)13-24-10-8-23(2)9-11-24/h3-7,12,14-15H,8-11,13H2,1-2H3/t15-/m0/s1.
What are the key properties of 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine?
5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine has a molecular weight of 336.44 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-methylpiperazin-1-yl)methyl]-3-[(1S)-1-phenylethyl]imidazo[4,5-b]pyrazine is sourced from PubChem (CID 90722764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).