About 4aH-pyrimido[5,4-d][2]benzazepin-2-amine
4aH-pyrimido[5,4-d][2]benzazepin-2-amine (PubChem CID 90722778) has the molecular formula C12H10N4
and a molecular weight of 210.24 g/mol. Its IUPAC name is 4aH-pyrimido[5,4-d][2]benzazepin-2-amine.
Molecular Properties
| Compound Name | 4aH-pyrimido[5,4-d][2]benzazepin-2-amine |
| PubChem CID | 90722778 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 4aH-pyrimido[5,4-d][2]benzazepin-2-amine |
| SMILES | NC1=NC2=c3ccccc3=CN=CC2C=N1 |
| InChI | InChI=1S/C12H10N4/c13-12-15-7-9-6-14-5-8-3-1-2-4-10(8)11(9)16-12/h1-7,9H,(H2,13,16) |
| InChIKey | HJTGUNMVSZPVCA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4aH-pyrimido[5,4-d][2]benzazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4aH-pyrimido[5,4-d][2]benzazepin-2-amine?
The IUPAC name of 4aH-pyrimido[5,4-d][2]benzazepin-2-amine (CID 90722778) is 4aH-pyrimido[5,4-d][2]benzazepin-2-amine.
What is the SMILES notation for 4aH-pyrimido[5,4-d][2]benzazepin-2-amine?
The canonical SMILES for 4aH-pyrimido[5,4-d][2]benzazepin-2-amine is NC1=NC2=c3ccccc3=CN=CC2C=N1.
What is the InChIKey of 4aH-pyrimido[5,4-d][2]benzazepin-2-amine?
The InChIKey is HJTGUNMVSZPVCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4/c13-12-15-7-9-6-14-5-8-3-1-2-4-10(8)11(9)16-12/h1-7,9H,(H2,13,16).
What are the key properties of 4aH-pyrimido[5,4-d][2]benzazepin-2-amine?
4aH-pyrimido[5,4-d][2]benzazepin-2-amine has a molecular weight of 210.24 g/mol, XLogP of -0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4aH-pyrimido[5,4-d][2]benzazepin-2-amine is sourced from PubChem (CID 90722778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).