C20H23F3N2O5 — CID 90722820
butyl 2-(cyclopentyliminomethyl)-3-oxo-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)propanoate (PubChem CID 90722820) has the molecular formula C20H23F3N2O5 and a molecular weight of 428.41 g/mol. Its IUPAC name is butyl 2-(cyclopentyliminomethyl)-3-oxo-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)propanoate.
| Compound Name | butyl 2-(cyclopentyliminomethyl)-3-oxo-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 90722820 |
| Molecular Formula | C20H23F3N2O5 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | butyl 2-(cyclopentyliminomethyl)-3-oxo-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)propanoate |
| SMILES | CCCCOC(=O)C(/C=N/C1CCCC1)C(=O)c1c(F)c(C)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23F3N2O5/c1-3-4-9-30-20(27)13(10-24-12-7-5-6-8-12)19(26)14-15(21)11(2)16(22)17(23)18(14)25(28)29/h10,12-13H,3-9H2,1-2H3/b24-10+ |
| InChIKey | QJEZGKJLTWQVPZ-YSURURNPSA-N |
| XLogP | 4.48 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|