About 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione
3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione (PubChem CID 90723524) has the molecular formula C13H12FN3O2
and a molecular weight of 261.26 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione |
| PubChem CID | 90723524 |
| Molecular Formula | C13H12FN3O2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione |
| SMILES | C=CC(=C)n1c(=O)[nH]c2cc(NC)c(F)cc2c1=O |
| InChI | InChI=1S/C13H12FN3O2/c1-4-7(2)17-12(18)8-5-9(14)11(15-3)6-10(8)16-13(17)19/h4-6,15H,1-2H2,3H3,(H,16,19) |
| InChIKey | SBFWUXCLCBKHGL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione?
The IUPAC name of 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione (CID 90723524) is 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione.
What is the SMILES notation for 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione?
The canonical SMILES for 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione is C=CC(=C)n1c(=O)[nH]c2cc(NC)c(F)cc2c1=O.
What is the InChIKey of 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione?
The InChIKey is SBFWUXCLCBKHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN3O2/c1-4-7(2)17-12(18)8-5-9(14)11(15-3)6-10(8)16-13(17)19/h4-6,15H,1-2H2,3H3,(H,16,19).
What are the key properties of 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione?
3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione has a molecular weight of 261.26 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-buta-1,3-dien-2-yl-6-fluoro-7-(methylamino)-1H-quinazoline-2,4-dione is sourced from PubChem (CID 90723524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).