About 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate
4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate (PubChem CID 90723702) has the molecular formula C26H34N2O7S
and a molecular weight of 518.63 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate |
| PubChem CID | 90723702 |
| Molecular Formula | C26H34N2O7S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)C[C@H]1CCOc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H34N2O7S/c1-26(2,3)35-25(30)28-16-15-27(24(29)34-19-20-8-6-5-7-9-20)18-21(28)14-17-33-22-10-12-23(13-11-22)36(4,31)32/h5-13,21H,14-19H2,1-4H3/t21-/m1/s1 |
| InChIKey | NDOHHZZAWZJZGE-OAQYLSRUSA-N |
| XLogP | 4.12 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate?
The IUPAC name of 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate (CID 90723702) is 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate.
What is the SMILES notation for 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate?
The canonical SMILES for 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate is CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)C[C@H]1CCOc1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate?
The InChIKey is NDOHHZZAWZJZGE-OAQYLSRUSA-N. The full InChI is InChI=1S/C26H34N2O7S/c1-26(2,3)35-25(30)28-16-15-27(24(29)34-19-20-8-6-5-7-9-20)18-21(28)14-17-33-22-10-12-23(13-11-22)36(4,31)32/h5-13,21H,14-19H2,1-4H3/t21-/m1/s1.
What are the key properties of 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate?
4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate has a molecular weight of 518.63 g/mol, XLogP of 4.12, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(4-methylsulfonylphenoxy)ethyl]piperazine-1,4-dicarboxylate is sourced from PubChem (CID 90723702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).