C17H26N2 — CID 90723925
but-2-yne;ethane;1,2,3,7-tetramethylpyrrolo[2,3-c]pyridine (PubChem CID 90723925) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is but-2-yne;ethane;1,2,3,7-tetramethylpyrrolo[2,3-c]pyridine.
| Compound Name | but-2-yne;ethane;1,2,3,7-tetramethylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 90723925 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | but-2-yne;ethane;1,2,3,7-tetramethylpyrrolo[2,3-c]pyridine |
| SMILES | CC.CC#CC.Cc1c(C)n(C)c2c(C)nccc12 |
| InChI | InChI=1S/C11H14N2.C4H6.C2H6/c1-7-9(3)13(4)11-8(2)12-6-5-10(7)11;1-3-4-2;1-2/h5-6H,1-4H3;1-2H3;1-2H3 |
| InChIKey | AZMIZPLGJGTVRS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|