C22H18Cl2F3N9O4 — CID 90723979
2,4-dichloro-6-methyl-5-nitropyrimidine;4-methyl-6-(2-methylimidazol-1-yl)-5-nitro-N-[[4-(trifluoromethyl)phenyl]methyl]pyrimidin-2-amine (PubChem CID 90723979) has the molecular formula C22H18Cl2F3N9O4 and a molecular weight of 600.35 g/mol. Its IUPAC name is 2,4-dichloro-6-methyl-5-nitropyrimidine;4-methyl-6-(2-methylimidazol-1-yl)-5-nitro-N-[[4-(trifluoromethyl)phenyl]methyl]pyrimidin-2-amine.
| Compound Name | 2,4-dichloro-6-methyl-5-nitropyrimidine;4-methyl-6-(2-methylimidazol-1-yl)-5-nitro-N-[[4-(trifluoromethyl)phenyl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 90723979 |
| Molecular Formula | C22H18Cl2F3N9O4 |
| Molecular Weight | 600.35 g/mol |
| Exact Mass | 599.08 |
| IUPAC Name | 2,4-dichloro-6-methyl-5-nitropyrimidine;4-methyl-6-(2-methylimidazol-1-yl)-5-nitro-N-[[4-(trifluoromethyl)phenyl]methyl]pyrimidin-2-amine |
| SMILES | Cc1nc(Cl)nc(Cl)c1[N+](=O)[O-].Cc1nc(NCc2ccc(C(F)(F)F)cc2)nc(-n2ccnc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15F3N6O2.C5H3Cl2N3O2/c1-10-14(26(27)28)15(25-8-7-21-11(25)2)24-16(23-10)22-9-12-3-5-13(6-4-12)17(18,19)20;1-2-3(10(11)12)4(6)9-5(7)8-2/h3-8H,9H2,1-2H3,(H,22,23,24);1H3 |
| InChIKey | OZCYOGFUJGFHCP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.35 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|