C30H30N10 — CID 90724121
2-(4-phenyltriazol-1-yl)-N,N-bis[2-(4-phenyltriazol-1-yl)ethyl]ethanamine (PubChem CID 90724121) has the molecular formula C30H30N10 and a molecular weight of 530.64 g/mol. Its IUPAC name is 2-(4-phenyltriazol-1-yl)-N,N-bis[2-(4-phenyltriazol-1-yl)ethyl]ethanamine.
| Compound Name | 2-(4-phenyltriazol-1-yl)-N,N-bis[2-(4-phenyltriazol-1-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 90724121 |
| Molecular Formula | C30H30N10 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 2-(4-phenyltriazol-1-yl)-N,N-bis[2-(4-phenyltriazol-1-yl)ethyl]ethanamine |
| SMILES | c1ccc(-c2cn(CCN(CCn3cc(-c4ccccc4)nn3)CCn3cc(-c4ccccc4)nn3)nn2)cc1 |
| InChI | InChI=1S/C30H30N10/c1-4-10-25(11-5-1)28-22-38(34-31-28)19-16-37(17-20-39-23-29(32-35-39)26-12-6-2-7-13-26)18-21-40-24-30(33-36-40)27-14-8-3-9-15-27/h1-15,22-24H,16-21H2 |
| InChIKey | ARGUBXWOSJEWPX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |