About (3S)-3-aminooxolan-2-one;ethane
(3S)-3-aminooxolan-2-one;ethane (PubChem CID 90724165) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is (3S)-3-aminooxolan-2-one;ethane.
Molecular Properties
| Compound Name | (3S)-3-aminooxolan-2-one;ethane |
| PubChem CID | 90724165 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (3S)-3-aminooxolan-2-one;ethane |
| SMILES | CC.N[C@H]1CCOC1=O |
| InChI | InChI=1S/C4H7NO2.C2H6/c5-3-1-2-7-4(3)6;1-2/h3H,1-2,5H2;1-2H3/t3-;/m0./s1 |
| InChIKey | HBXXPUGQGIPPGW-DFWYDOINSA-N |
| XLogP | 0.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-aminooxolan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-aminooxolan-2-one;ethane?
The IUPAC name of (3S)-3-aminooxolan-2-one;ethane (CID 90724165) is (3S)-3-aminooxolan-2-one;ethane.
What is the SMILES notation for (3S)-3-aminooxolan-2-one;ethane?
The canonical SMILES for (3S)-3-aminooxolan-2-one;ethane is CC.N[C@H]1CCOC1=O.
What is the InChIKey of (3S)-3-aminooxolan-2-one;ethane?
The InChIKey is HBXXPUGQGIPPGW-DFWYDOINSA-N. The full InChI is InChI=1S/C4H7NO2.C2H6/c5-3-1-2-7-4(3)6;1-2/h3H,1-2,5H2;1-2H3/t3-;/m0./s1.
What are the key properties of (3S)-3-aminooxolan-2-one;ethane?
(3S)-3-aminooxolan-2-one;ethane has a molecular weight of 131.18 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-aminooxolan-2-one;ethane is sourced from PubChem (CID 90724165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).