C17H13N3O3 — CID 90724626
2-oxa-3,4,5-triazabicyclo[15.4.0]henicosa-1(21),3,5,7,9,11,14,17,19-nonaene-13,16-dione (PubChem CID 90724626) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-oxa-3,4,5-triazabicyclo[15.4.0]henicosa-1(21),3,5,7,9,11,14,17,19-nonaene-13,16-dione.
| Compound Name | 2-oxa-3,4,5-triazabicyclo[15.4.0]henicosa-1(21),3,5,7,9,11,14,17,19-nonaene-13,16-dione |
|---|---|
| PubChem CID | 90724626 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-oxa-3,4,5-triazabicyclo[15.4.0]henicosa-1(21),3,5,7,9,11,14,17,19-nonaene-13,16-dione |
| SMILES | O=C1C=CC=CC=CC=NN=NOc2ccccc2C(=O)C=C1 |
| InChI | InChI=1S/C17H13N3O3/c21-14-8-4-2-1-3-7-13-18-19-20-23-17-10-6-5-9-15(17)16(22)12-11-14/h1-13H |
| InChIKey | YSJDGERCHPZYON-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |