C21H35N3O5 — CID 9072471
[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 9072471) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 9072471 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@@H]1CCCC[C@]12NC(=O)N(CC(=O)OCC(=O)NC(C)(C)CC(C)(C)C)C2=O |
| InChI | InChI=1S/C21H35N3O5/c1-14-9-7-8-10-21(14)17(27)24(18(28)23-21)11-16(26)29-12-15(25)22-20(5,6)13-19(2,3)4/h14H,7-13H2,1-6H3,(H,22,25)(H,23,28)/t14-,21+/m1/s1 |
| InChIKey | NZAPXRHACGPRTN-SZNDQCEHSA-N |
| XLogP | 2.36 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|