About ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine
ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine (PubChem CID 90724739) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine |
| PubChem CID | 90724739 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine |
| SMILES | C=C1Nc2cccnc2N1.CC |
| InChI | InChI=1S/C7H7N3.C2H6/c1-5-9-6-3-2-4-8-7(6)10-5;1-2/h2-4,9H,1H2,(H,8,10);1-2H3 |
| InChIKey | MIFNFZMNIUKKHZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine?
The IUPAC name of ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine (CID 90724739) is ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine.
What is the SMILES notation for ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine?
The canonical SMILES for ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine is C=C1Nc2cccnc2N1.CC.
What is the InChIKey of ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine?
The InChIKey is MIFNFZMNIUKKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.C2H6/c1-5-9-6-3-2-4-8-7(6)10-5;1-2/h2-4,9H,1H2,(H,8,10);1-2H3.
What are the key properties of ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine?
ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine has a molecular weight of 163.22 g/mol, XLogP of 2.42, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylidene-1,3-dihydroimidazo[4,5-b]pyridine is sourced from PubChem (CID 90724739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).