About ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol
ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol (PubChem CID 90725026) has the molecular formula C22H25N3O3
and a molecular weight of 379.46 g/mol. Its IUPAC name is ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol.
Molecular Properties
| Compound Name | ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol |
| PubChem CID | 90725026 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol |
| SMILES | CC.O=Nc1c(O)cc(N2CCN(c3ccc(O)cc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C20H19N3O3.C2H6/c24-15-7-5-14(6-8-15)22-9-11-23(12-10-22)18-13-19(25)20(21-26)17-4-2-1-3-16(17)18;1-2/h1-8,13,24-25H,9-12H2;1-2H3 |
| InChIKey | RHTAMMOYAWCVDJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol?
The IUPAC name of ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol (CID 90725026) is ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol.
What is the SMILES notation for ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol?
The canonical SMILES for ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol is CC.O=Nc1c(O)cc(N2CCN(c3ccc(O)cc3)CC2)c2ccccc12.
What is the InChIKey of ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol?
The InChIKey is RHTAMMOYAWCVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O3.C2H6/c24-15-7-5-14(6-8-15)22-9-11-23(12-10-22)18-13-19(25)20(21-26)17-4-2-1-3-16(17)18;1-2/h1-8,13,24-25H,9-12H2;1-2H3.
What are the key properties of ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol?
ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol has a molecular weight of 379.46 g/mol, XLogP of 5.00, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-nitrosonaphthalen-2-ol is sourced from PubChem (CID 90725026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).