C35H30N5O5S+ — CID 90725376
[9-[2-carboxy-5-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propylcarbamoyl]phenyl]-6-(methylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 90725376) has the molecular formula C35H30N5O5S+ and a molecular weight of 632.72 g/mol. Its IUPAC name is [9-[2-carboxy-5-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propylcarbamoyl]phenyl]-6-(methylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-carboxy-5-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propylcarbamoyl]phenyl]-6-(methylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 90725376 |
| Molecular Formula | C35H30N5O5S+ |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | [9-[2-carboxy-5-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propylcarbamoyl]phenyl]-6-(methylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CNc1ccc2c(-c3cc(C(=O)NCCCOc4ccc5nc(C#N)sc5c4)ccc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C35H29N5O5S/c1-37-21-6-10-25-29(16-21)45-30-17-22(40(2)3)7-11-26(30)33(25)27-15-20(5-9-24(27)35(42)43)34(41)38-13-4-14-44-23-8-12-28-31(18-23)46-32(19-36)39-28/h5-12,15-18H,4,13-14H2,1-3H3,(H2,38,41,42,43)/p+1 |
| InChIKey | ROSSMDZRUIHQEI-UHFFFAOYSA-O |
| XLogP | 5.66 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|