About 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine
3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine (PubChem CID 90725396) has the molecular formula C16H12Cl10N2O4
and a molecular weight of 650.81 g/mol. Its IUPAC name is 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine.
Molecular Properties
| Compound Name | 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine |
| PubChem CID | 90725396 |
| Molecular Formula | C16H12Cl10N2O4 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 645.77 |
| IUPAC Name | 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine |
| SMILES | COc1nc(C(Cl)(Cl)Cl)c(Cl)c(OC)c1Cl.COc1nc(C(Cl)(Cl)Cl)c(Cl)c(OC)c1Cl |
| InChI | InChI=1S/2C8H6Cl5NO2/c2*1-15-5-3(9)6(8(11,12)13)14-7(16-2)4(5)10/h2*1-2H3 |
| InChIKey | LSCKLPOGPCJCEG-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine?
The IUPAC name of 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine (CID 90725396) is 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine.
What is the SMILES notation for 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine?
The canonical SMILES for 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine is COc1nc(C(Cl)(Cl)Cl)c(Cl)c(OC)c1Cl.COc1nc(C(Cl)(Cl)Cl)c(Cl)c(OC)c1Cl.
What is the InChIKey of 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine?
The InChIKey is LSCKLPOGPCJCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H6Cl5NO2/c2*1-15-5-3(9)6(8(11,12)13)14-7(16-2)4(5)10/h2*1-2H3.
What are the key properties of 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine?
3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine has a molecular weight of 650.81 g/mol, XLogP of 8.46, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine is sourced from PubChem (CID 90725396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).