About 3-(furan-2-ylmethyl)-1,2,4-oxadiazole
3-(furan-2-ylmethyl)-1,2,4-oxadiazole (PubChem CID 90725557) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(furan-2-ylmethyl)-1,2,4-oxadiazole |
| PubChem CID | 90725557 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 3-(furan-2-ylmethyl)-1,2,4-oxadiazole |
| SMILES | c1coc(Cc2ncon2)c1 |
| InChI | InChI=1S/C7H6N2O2/c1-2-6(10-3-1)4-7-8-5-11-9-7/h1-3,5H,4H2 |
| InChIKey | DHWPIFJDKBARLB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(furan-2-ylmethyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-ylmethyl)-1,2,4-oxadiazole?
The IUPAC name of 3-(furan-2-ylmethyl)-1,2,4-oxadiazole (CID 90725557) is 3-(furan-2-ylmethyl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-(furan-2-ylmethyl)-1,2,4-oxadiazole?
The canonical SMILES for 3-(furan-2-ylmethyl)-1,2,4-oxadiazole is c1coc(Cc2ncon2)c1.
What is the InChIKey of 3-(furan-2-ylmethyl)-1,2,4-oxadiazole?
The InChIKey is DHWPIFJDKBARLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c1-2-6(10-3-1)4-7-8-5-11-9-7/h1-3,5H,4H2.
What are the key properties of 3-(furan-2-ylmethyl)-1,2,4-oxadiazole?
3-(furan-2-ylmethyl)-1,2,4-oxadiazole has a molecular weight of 150.14 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-ylmethyl)-1,2,4-oxadiazole is sourced from PubChem (CID 90725557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).