C20H28N2O10 — CID 90725674
(2,5-dihydroxypyrrol-1-yl) 4-oxo-4-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methylamino]butanoate (PubChem CID 90725674) has the molecular formula C20H28N2O10 and a molecular weight of 456.45 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-oxo-4-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methylamino]butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-oxo-4-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methylamino]butanoate |
|---|---|
| PubChem CID | 90725674 |
| Molecular Formula | C20H28N2O10 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-oxo-4-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methylamino]butanoate |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(CNC(=O)CCC(=O)On4c(O)ccc4O)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C20H28N2O10/c1-18(2)28-11-9-27-20(17(16(11)29-18)30-19(3,4)32-20)10-21-12(23)5-8-15(26)31-22-13(24)6-7-14(22)25/h6-7,11,16-17,24-25H,5,8-10H2,1-4H3,(H,21,23)/t11-,16-,17+,20+/m1/s1 |
| InChIKey | QIQWOMREKDIJBN-VRZRXGSGSA-N |
| XLogP | 0.15 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |