About N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine
N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine (PubChem CID 90725700) has the molecular formula C22H16ClF2N3
and a molecular weight of 395.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine |
| PubChem CID | 90725700 |
| Molecular Formula | C22H16ClF2N3 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine |
| SMILES | Cc1ccc(N(Cc2ccnc3c(F)c(F)ccc23)c2cccc(Cl)c2)nc1 |
| InChI | InChI=1S/C22H16ClF2N3/c1-14-5-8-20(27-12-14)28(17-4-2-3-16(23)11-17)13-15-9-10-26-22-18(15)6-7-19(24)21(22)25/h2-12H,13H2,1H3 |
| InChIKey | HFWJGRZEJUNGKE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine?
The IUPAC name of N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine (CID 90725700) is N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine.
What is the SMILES notation for N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine?
The canonical SMILES for N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine is Cc1ccc(N(Cc2ccnc3c(F)c(F)ccc23)c2cccc(Cl)c2)nc1.
What is the InChIKey of N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine?
The InChIKey is HFWJGRZEJUNGKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClF2N3/c1-14-5-8-20(27-12-14)28(17-4-2-3-16(23)11-17)13-15-9-10-26-22-18(15)6-7-19(24)21(22)25/h2-12H,13H2,1H3.
What are the key properties of N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine?
N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine has a molecular weight of 395.84 g/mol, XLogP of 6.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-N-[(7,8-difluoroquinolin-4-yl)methyl]-5-methylpyridin-2-amine is sourced from PubChem (CID 90725700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).