C21H22N4 — CID 90725831
N-phenyl-6-piperidin-1-yl-1,2-dihydroindeno[1,2-c]pyrazol-3-amine (PubChem CID 90725831) has the molecular formula C21H22N4 and a molecular weight of 330.44 g/mol. Its IUPAC name is N-phenyl-6-piperidin-1-yl-1,2-dihydroindeno[1,2-c]pyrazol-3-amine.
| Compound Name | N-phenyl-6-piperidin-1-yl-1,2-dihydroindeno[1,2-c]pyrazol-3-amine |
|---|---|
| PubChem CID | 90725831 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | N-phenyl-6-piperidin-1-yl-1,2-dihydroindeno[1,2-c]pyrazol-3-amine |
| SMILES | c1ccc(Nc2[nH][nH]c3c4ccc(N5CCCCC5)cc4cc2-3)cc1 |
| InChI | InChI=1S/C21H22N4/c1-3-7-16(8-4-1)22-21-19-14-15-13-17(25-11-5-2-6-12-25)9-10-18(15)20(19)23-24-21/h1,3-4,7-10,13-14,22-24H,2,5-6,11-12H2 |
| InChIKey | NBTXYXGDFBKFJY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 46.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |