C29H35N5O5Si — CID 90726157
[2-(dimethylcarbamoyl)-4-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]carbamic acid (PubChem CID 90726157) has the molecular formula C29H35N5O5Si and a molecular weight of 561.72 g/mol. Its IUPAC name is [2-(dimethylcarbamoyl)-4-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]carbamic acid.
| Compound Name | [2-(dimethylcarbamoyl)-4-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 90726157 |
| Molecular Formula | C29H35N5O5Si |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | [2-(dimethylcarbamoyl)-4-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]phenyl]carbamic acid |
| SMILES | COc1ccccc1-c1nn(COCC[Si](C)(C)C)c2ncc(-c3ccc(NC(=O)O)c(C(=O)N(C)C)c3)cc12 |
| InChI | InChI=1S/C29H35N5O5Si/c1-33(2)28(35)22-15-19(11-12-24(22)31-29(36)37)20-16-23-26(21-9-7-8-10-25(21)38-3)32-34(27(23)30-17-20)18-39-13-14-40(4,5)6/h7-12,15-17,31H,13-14,18H2,1-6H3,(H,36,37) |
| InChIKey | VTINMBAUWJUNJF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|