About 6-sulfanylidenedodeca-2,4,7,10-tetraenethial
6-sulfanylidenedodeca-2,4,7,10-tetraenethial (PubChem CID 90726222) has the molecular formula C12H14S2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 6-sulfanylidenedodeca-2,4,7,10-tetraenethial.
Molecular Properties
| Compound Name | 6-sulfanylidenedodeca-2,4,7,10-tetraenethial |
| PubChem CID | 90726222 |
| Molecular Formula | C12H14S2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 6-sulfanylidenedodeca-2,4,7,10-tetraenethial |
| SMILES | CC=CCC=CC(=S)C=CC=CC=S |
| InChI | InChI=1S/C12H14S2/c1-2-3-4-6-9-12(14)10-7-5-8-11-13/h2-3,5-11H,4H2,1H3 |
| InChIKey | VQDSDBSCKXWTDA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfanylidenedodeca-2,4,7,10-tetraenethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfanylidenedodeca-2,4,7,10-tetraenethial?
The IUPAC name of 6-sulfanylidenedodeca-2,4,7,10-tetraenethial (CID 90726222) is 6-sulfanylidenedodeca-2,4,7,10-tetraenethial.
What is the SMILES notation for 6-sulfanylidenedodeca-2,4,7,10-tetraenethial?
The canonical SMILES for 6-sulfanylidenedodeca-2,4,7,10-tetraenethial is CC=CCC=CC(=S)C=CC=CC=S.
What is the InChIKey of 6-sulfanylidenedodeca-2,4,7,10-tetraenethial?
The InChIKey is VQDSDBSCKXWTDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14S2/c1-2-3-4-6-9-12(14)10-7-5-8-11-13/h2-3,5-11H,4H2,1H3.
What are the key properties of 6-sulfanylidenedodeca-2,4,7,10-tetraenethial?
6-sulfanylidenedodeca-2,4,7,10-tetraenethial has a molecular weight of 222.38 g/mol, XLogP of 3.99, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfanylidenedodeca-2,4,7,10-tetraenethial is sourced from PubChem (CID 90726222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).