About 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol
1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol (PubChem CID 90726226) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol.
Molecular Properties
| Compound Name | 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol |
| PubChem CID | 90726226 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol |
| SMILES | CC=CC(=CC)OCC(O)CN |
| InChI | InChI=1S/C9H17NO2/c1-3-5-9(4-2)12-7-8(11)6-10/h3-5,8,11H,6-7,10H2,1-2H3 |
| InChIKey | KZZAKOZKAFECOT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol?
The IUPAC name of 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol (CID 90726226) is 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol.
What is the SMILES notation for 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol?
The canonical SMILES for 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol is CC=CC(=CC)OCC(O)CN.
What is the InChIKey of 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol?
The InChIKey is KZZAKOZKAFECOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-3-5-9(4-2)12-7-8(11)6-10/h3-5,8,11H,6-7,10H2,1-2H3.
What are the key properties of 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol?
1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol has a molecular weight of 171.24 g/mol, XLogP of 0.80, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-hexa-2,4-dien-3-yloxypropan-2-ol is sourced from PubChem (CID 90726226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).