About 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile
4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile (PubChem CID 90726230) has the molecular formula C14H18N4
and a molecular weight of 242.33 g/mol. Its IUPAC name is 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile |
| PubChem CID | 90726230 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile |
| SMILES | C/N=C1\CC(C#N)CC=C1NC1=NC=CC(C)C1 |
| InChI | InChI=1S/C14H18N4/c1-10-5-6-17-14(7-10)18-12-4-3-11(9-15)8-13(12)16-2/h4-6,10-11H,3,7-8H2,1-2H3,(H,17,18)/b16-13+ |
| InChIKey | XWIGBFKVXBLKFB-DTQAZKPQSA-N |
| XLogP | 2.42 |
| TPSA | 60.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile?
The IUPAC name of 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile (CID 90726230) is 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile.
What is the SMILES notation for 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile?
The canonical SMILES for 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile is C/N=C1\CC(C#N)CC=C1NC1=NC=CC(C)C1.
What is the InChIKey of 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile?
The InChIKey is XWIGBFKVXBLKFB-DTQAZKPQSA-N. The full InChI is InChI=1S/C14H18N4/c1-10-5-6-17-14(7-10)18-12-4-3-11(9-15)8-13(12)16-2/h4-6,10-11H,3,7-8H2,1-2H3,(H,17,18)/b16-13+.
What are the key properties of 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile?
4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile has a molecular weight of 242.33 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methyl-3,4-dihydropyridin-2-yl)amino]-5-methyliminocyclohex-3-ene-1-carbonitrile is sourced from PubChem (CID 90726230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).