About 4-(chloromethyl)-6,7-dimethylchromen-2-one
4-(chloromethyl)-6,7-dimethylchromen-2-one (PubChem CID 907265) has the molecular formula C12H11ClO2
and a molecular weight of 222.67 g/mol. Its IUPAC name is 4-(chloromethyl)-6,7-dimethylchromen-2-one.
Molecular Properties
| Compound Name | 4-(chloromethyl)-6,7-dimethylchromen-2-one |
| PubChem CID | 907265 |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 4-(chloromethyl)-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CCl)c2cc1C |
| InChI | InChI=1S/C12H11ClO2/c1-7-3-10-9(6-13)5-12(14)15-11(10)4-8(7)2/h3-5H,6H2,1-2H3 |
| InChIKey | CLYXXOOLIRDIPC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-6,7-dimethylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-6,7-dimethylchromen-2-one?
The IUPAC name of 4-(chloromethyl)-6,7-dimethylchromen-2-one (CID 907265) is 4-(chloromethyl)-6,7-dimethylchromen-2-one.
What is the SMILES notation for 4-(chloromethyl)-6,7-dimethylchromen-2-one?
The canonical SMILES for 4-(chloromethyl)-6,7-dimethylchromen-2-one is Cc1cc2oc(=O)cc(CCl)c2cc1C.
What is the InChIKey of 4-(chloromethyl)-6,7-dimethylchromen-2-one?
The InChIKey is CLYXXOOLIRDIPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClO2/c1-7-3-10-9(6-13)5-12(14)15-11(10)4-8(7)2/h3-5H,6H2,1-2H3.
What are the key properties of 4-(chloromethyl)-6,7-dimethylchromen-2-one?
4-(chloromethyl)-6,7-dimethylchromen-2-one has a molecular weight of 222.67 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-6,7-dimethylchromen-2-one is sourced from PubChem (CID 907265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).