C16H15F3NO4+ — CID 90726626
methyl 2-[2-(3H-pyrrol-1-ium-1-yl)acetyl]oxy-2-[4-(trifluoromethyl)phenyl]acetate (PubChem CID 90726626) has the molecular formula C16H15F3NO4+ and a molecular weight of 342.29 g/mol. Its IUPAC name is methyl 2-[2-(3H-pyrrol-1-ium-1-yl)acetyl]oxy-2-[4-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-[2-(3H-pyrrol-1-ium-1-yl)acetyl]oxy-2-[4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 90726626 |
| Molecular Formula | C16H15F3NO4+ |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | methyl 2-[2-(3H-pyrrol-1-ium-1-yl)acetyl]oxy-2-[4-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)C(OC(=O)C[N+]1=CCC=C1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3NO4/c1-23-15(22)14(24-13(21)10-20-8-2-3-9-20)11-4-6-12(7-5-11)16(17,18)19/h2,4-9,14H,3,10H2,1H3/q+1 |
| InChIKey | JEOQUTCURHTYSX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|