C15H23N5 — CID 90726729
(3Z)-2-methylimino-N'-[(Z)-1-piperidin-4-ylethylideneamino]hepta-3,5,6-trienimidamide (PubChem CID 90726729) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is (3Z)-2-methylimino-N'-[(Z)-1-piperidin-4-ylethylideneamino]hepta-3,5,6-trienimidamide.
| Compound Name | (3Z)-2-methylimino-N'-[(Z)-1-piperidin-4-ylethylideneamino]hepta-3,5,6-trienimidamide |
|---|---|
| PubChem CID | 90726729 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | (3Z)-2-methylimino-N'-[(Z)-1-piperidin-4-ylethylideneamino]hepta-3,5,6-trienimidamide |
| SMILES | C=C=C/C=C\C(=N/C)C(N)=N/N=C(/C)C1CCNCC1 |
| InChI | InChI=1S/C15H23N5/c1-4-5-6-7-14(17-3)15(16)20-19-12(2)13-8-10-18-11-9-13/h5-7,13,18H,1,8-11H2,2-3H3,(H2,16,20)/b7-6-,17-14+,19-12- |
| InChIKey | XIDWOCDPHRTQNF-KMBHPHMUSA-N |
| XLogP | 1.69 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|