C12H16F3NOS — CID 90726805
2-amino-4-methylsulfanyl-3-[4-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 90726805) has the molecular formula C12H16F3NOS and a molecular weight of 279.33 g/mol. Its IUPAC name is 2-amino-4-methylsulfanyl-3-[4-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | 2-amino-4-methylsulfanyl-3-[4-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 90726805 |
| Molecular Formula | C12H16F3NOS |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-amino-4-methylsulfanyl-3-[4-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | CSCC(c1ccc(C(F)(F)F)cc1)C(N)CO |
| InChI | InChI=1S/C12H16F3NOS/c1-18-7-10(11(16)6-17)8-2-4-9(5-3-8)12(13,14)15/h2-5,10-11,17H,6-7,16H2,1H3 |
| InChIKey | BWXVBRUQJSLNHA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |