About 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol
1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol (PubChem CID 90727536) has the molecular formula C23H33N3O2
and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol |
| PubChem CID | 90727536 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol |
| SMILES | C=C(C)Cc1c(C)c(O)n(CCCN2CCN(Cc3ccccc3)CC2)c1O |
| InChI | InChI=1S/C23H33N3O2/c1-18(2)16-21-19(3)22(27)26(23(21)28)11-7-10-24-12-14-25(15-13-24)17-20-8-5-4-6-9-20/h4-6,8-9,27-28H,1,7,10-17H2,2-3H3 |
| InChIKey | WFQCDRFRYOQQSP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol?
The IUPAC name of 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol (CID 90727536) is 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol.
What is the SMILES notation for 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol?
The canonical SMILES for 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol is C=C(C)Cc1c(C)c(O)n(CCCN2CCN(Cc3ccccc3)CC2)c1O.
What is the InChIKey of 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol?
The InChIKey is WFQCDRFRYOQQSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33N3O2/c1-18(2)16-21-19(3)22(27)26(23(21)28)11-7-10-24-12-14-25(15-13-24)17-20-8-5-4-6-9-20/h4-6,8-9,27-28H,1,7,10-17H2,2-3H3.
What are the key properties of 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol?
1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol has a molecular weight of 383.54 g/mol, XLogP of 3.53, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-(2-methylprop-2-enyl)pyrrole-2,5-diol is sourced from PubChem (CID 90727536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).