C10H11NS — CID 90727811
1-(1-azacyclohepta-2,4,6,7-tetraen-3-yl)but-3-ene-1-thiol (PubChem CID 90727811) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 1-(1-azacyclohepta-2,4,6,7-tetraen-3-yl)but-3-ene-1-thiol.
| Compound Name | 1-(1-azacyclohepta-2,4,6,7-tetraen-3-yl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 90727811 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 1-(1-azacyclohepta-2,4,6,7-tetraen-3-yl)but-3-ene-1-thiol |
| SMILES | C=CCC(S)C1=CN=C=CC=C1 |
| InChI | InChI=1S/C10H11NS/c1-2-5-10(12)9-6-3-4-7-11-8-9/h2-4,6,8,10,12H,1,5H2 |
| InChIKey | RKNRBYIYQBSZQV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|