C19H27N5O6 — CID 90728075
3-methyl-5-[3-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]-2,6-dioxopyrimidin-4-olate;triethylazanium (PubChem CID 90728075) has the molecular formula C19H27N5O6 and a molecular weight of 421.45 g/mol. Its IUPAC name is 3-methyl-5-[3-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]-2,6-dioxopyrimidin-4-olate;triethylazanium.
| Compound Name | 3-methyl-5-[3-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]-2,6-dioxopyrimidin-4-olate;triethylazanium |
|---|---|
| PubChem CID | 90728075 |
| Molecular Formula | C19H27N5O6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 3-methyl-5-[3-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]-2,6-dioxopyrimidin-4-olate;triethylazanium |
| SMILES | CC[NH+](CC)CC.CN1C(=O)NC(=O)C(=CC=Cc2c([O-])n(C)c(=O)[nH]c2=O)C1=O |
| InChI | InChI=1S/C13H12N4O6.C6H15N/c1-16-10(20)6(8(18)14-12(16)22)4-3-5-7-9(19)15-13(23)17(2)11(7)21;1-4-7(5-2)6-3/h3-5,20H,1-2H3,(H,14,18,22)(H,15,19,23);4-6H2,1-3H3 |
| InChIKey | MDQNUWJBVJUDNE-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 148.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|