About 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile
4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile (PubChem CID 90728193) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile.
Molecular Properties
| Compound Name | 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile |
| PubChem CID | 90728193 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile |
| SMILES | CC=CC(=CC)C(O)C(O)(O)C#N |
| InChI | InChI=1S/C9H13NO3/c1-3-5-7(4-2)8(11)9(12,13)6-10/h3-5,8,11-13H,1-2H3 |
| InChIKey | NFIPHUNSZWMOKU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile?
The IUPAC name of 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile (CID 90728193) is 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile.
What is the SMILES notation for 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile?
The canonical SMILES for 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile is CC=CC(=CC)C(O)C(O)(O)C#N.
What is the InChIKey of 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile?
The InChIKey is NFIPHUNSZWMOKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-3-5-7(4-2)8(11)9(12,13)6-10/h3-5,8,11-13H,1-2H3.
What are the key properties of 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile?
4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile has a molecular weight of 183.21 g/mol, XLogP of 0.07, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylidene-2,2,3-trihydroxyhept-5-enenitrile is sourced from PubChem (CID 90728193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).