C32H31N3O5 — CID 90728619
1-[(15R)-3,16-dihydroxy-15-methyl-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1(26),2,5,7(27),8,10,12,20,22,24-decaen-16-yl]hexyl formate (PubChem CID 90728619) has the molecular formula C32H31N3O5 and a molecular weight of 537.62 g/mol. Its IUPAC name is 1-[(15R)-3,16-dihydroxy-15-methyl-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1(26),2,5,7(27),8,10,12,20,22,24-decaen-16-yl]hexyl formate.
| Compound Name | 1-[(15R)-3,16-dihydroxy-15-methyl-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1(26),2,5,7(27),8,10,12,20,22,24-decaen-16-yl]hexyl formate |
|---|---|
| PubChem CID | 90728619 |
| Molecular Formula | C32H31N3O5 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 1-[(15R)-3,16-dihydroxy-15-methyl-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1(26),2,5,7(27),8,10,12,20,22,24-decaen-16-yl]hexyl formate |
| SMILES | CCCCCC(OC=O)C1(O)CC2O[C@@]1(C)n1c3ccccc3c3c4c[nH]c(O)c4c4c5ccccc5n2c4c31 |
| InChI | InChI=1S/C32H31N3O5/c1-3-4-5-14-23(39-17-36)32(38)15-24-34-21-12-8-6-10-18(21)26-27-20(16-33-30(27)37)25-19-11-7-9-13-22(19)35(29(25)28(26)34)31(32,2)40-24/h6-13,16-17,23-24,33,37-38H,3-5,14-15H2,1-2H3/t23?,24?,31-,32?/m1/s1 |
| InChIKey | VNLNBLJFHSMXHJ-QLJKGHKJSA-N |
| XLogP | 6.55 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|