C29H30N2O6 — CID 90728803
6-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (PubChem CID 90728803) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is 6-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid.
| Compound Name | 6-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 90728803 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 6-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| SMILES | O=C(NC(CCCCn1c(O)c2c(c1O)CC=CC2)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H30N2O6/c32-26-22-13-5-6-14-23(22)27(33)31(26)16-8-7-15-25(28(34)35)30-29(36)37-17-24-20-11-3-1-9-18(20)19-10-2-4-12-21(19)24/h1-6,9-12,24-25,32-33H,7-8,13-17H2,(H,30,36)(H,34,35) |
| InChIKey | XQAIZFJNMAUZHD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|