About 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole
4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole (PubChem CID 90729158) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole |
| PubChem CID | 90729158 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole |
| SMILES | CCCCOC1CCN=C1c1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-2-3-11-16-13-9-10-15-14(13)12-7-5-4-6-8-12/h4-8,13H,2-3,9-11H2,1H3 |
| InChIKey | ZPXDQWGHOYQBHX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole?
The IUPAC name of 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole (CID 90729158) is 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole is CCCCOC1CCN=C1c1ccccc1.
What is the InChIKey of 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole?
The InChIKey is ZPXDQWGHOYQBHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-2-3-11-16-13-9-10-15-14(13)12-7-5-4-6-8-12/h4-8,13H,2-3,9-11H2,1H3.
What are the key properties of 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole?
4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole has a molecular weight of 217.31 g/mol, XLogP of 3.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-5-phenyl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 90729158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).