C25H21Cl2NO2S — CID 90729424
[2-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-oxazin-4-yl]-(3,5-dichloro-4-phenylmethoxyphenyl)methanethione (PubChem CID 90729424) has the molecular formula C25H21Cl2NO2S and a molecular weight of 470.42 g/mol. Its IUPAC name is [2-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-oxazin-4-yl]-(3,5-dichloro-4-phenylmethoxyphenyl)methanethione.
| Compound Name | [2-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-oxazin-4-yl]-(3,5-dichloro-4-phenylmethoxyphenyl)methanethione |
|---|---|
| PubChem CID | 90729424 |
| Molecular Formula | C25H21Cl2NO2S |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | [2-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-oxazin-4-yl]-(3,5-dichloro-4-phenylmethoxyphenyl)methanethione |
| SMILES | S=C(c1cc(Cl)c(OCc2ccccc2)c(Cl)c1)N1C=COC(CC2=CC=CCC2)=C1 |
| InChI | InChI=1S/C25H21Cl2NO2S/c26-22-14-20(15-23(27)24(22)30-17-19-9-5-2-6-10-19)25(31)28-11-12-29-21(16-28)13-18-7-3-1-4-8-18/h1-3,5-7,9-12,14-16H,4,8,13,17H2 |
| InChIKey | FHRGTIWHBYVJPW-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|