About piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate
piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate (PubChem CID 90729462) has the molecular formula C16H21N3O4
and a molecular weight of 319.36 g/mol. Its IUPAC name is piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate.
Molecular Properties
| Compound Name | piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate |
| PubChem CID | 90729462 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(Cc1ccc([N+](=O)[O-])cc1)C(=O)OC1CCNCC1 |
| InChI | InChI=1S/C16H21N3O4/c1-2-11-18(16(20)23-15-7-9-17-10-8-15)12-13-3-5-14(6-4-13)19(21)22/h2-6,15,17H,1,7-12H2 |
| InChIKey | GOXCRBKKGBCOFP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate?
The IUPAC name of piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate (CID 90729462) is piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate.
What is the SMILES notation for piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate?
The canonical SMILES for piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate is C=CCN(Cc1ccc([N+](=O)[O-])cc1)C(=O)OC1CCNCC1.
What is the InChIKey of piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate?
The InChIKey is GOXCRBKKGBCOFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O4/c1-2-11-18(16(20)23-15-7-9-17-10-8-15)12-13-3-5-14(6-4-13)19(21)22/h2-6,15,17H,1,7-12H2.
What are the key properties of piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate?
piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate has a molecular weight of 319.36 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl N-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamate is sourced from PubChem (CID 90729462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).